C19H32O7 — CID 174398632
4-methylhex-1-en-3-ol;tris(2-methylprop-2-enoic acid) (PubChem CID 174398632) has the molecular formula C19H32O7 and a molecular weight of 372.46 g/mol. Its IUPAC name is 4-methylhex-1-en-3-ol;tris(2-methylprop-2-enoic acid).
| Compound Name | 4-methylhex-1-en-3-ol;tris(2-methylprop-2-enoic acid) |
|---|---|
| PubChem CID | 174398632 |
| Molecular Formula | C19H32O7 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 4-methylhex-1-en-3-ol;tris(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.C=C(C)C(=O)O.C=CC(O)C(C)CC |
| InChI | InChI=1S/C7H14O.3C4H6O2/c1-4-6(3)7(8)5-2;3*1-3(2)4(5)6/h5-8H,2,4H2,1,3H3;3*1H2,2H3,(H,5,6) |
| InChIKey | HWVALXSLEXADLD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|