About 1-[2-(1-hydroxypropoxy)propoxy]propan-1-ol;2-methylprop-2-enoic acid
1-[2-(1-hydroxypropoxy)propoxy]propan-1-ol;2-methylprop-2-enoic acid (PubChem CID 174847356) has the molecular formula C13H26O6
and a molecular weight of 278.35 g/mol. Its IUPAC name is 1-[2-(1-hydroxypropoxy)propoxy]propan-1-ol;2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | 1-[2-(1-hydroxypropoxy)propoxy]propan-1-ol;2-methylprop-2-enoic acid |
| PubChem CID | 174847356 |
| Molecular Formula | C13H26O6 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-[2-(1-hydroxypropoxy)propoxy]propan-1-ol;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CCC(O)OCC(C)OC(O)CC |
| InChI | InChI=1S/C9H20O4.C4H6O2/c1-4-8(10)12-6-7(3)13-9(11)5-2;1-3(2)4(5)6/h7-11H,4-6H2,1-3H3;1H2,2H3,(H,5,6) |
| InChIKey | RDQIIDAGVWJVCO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(1-hydroxypropoxy)propoxy]propan-1-ol;2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1-hydroxypropoxy)propoxy]propan-1-ol;2-methylprop-2-enoic acid?
The IUPAC name of 1-[2-(1-hydroxypropoxy)propoxy]propan-1-ol;2-methylprop-2-enoic acid (CID 174847356) is 1-[2-(1-hydroxypropoxy)propoxy]propan-1-ol;2-methylprop-2-enoic acid.
What is the SMILES notation for 1-[2-(1-hydroxypropoxy)propoxy]propan-1-ol;2-methylprop-2-enoic acid?
The canonical SMILES for 1-[2-(1-hydroxypropoxy)propoxy]propan-1-ol;2-methylprop-2-enoic acid is C=C(C)C(=O)O.CCC(O)OCC(C)OC(O)CC.
What is the InChIKey of 1-[2-(1-hydroxypropoxy)propoxy]propan-1-ol;2-methylprop-2-enoic acid?
The InChIKey is RDQIIDAGVWJVCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O4.C4H6O2/c1-4-8(10)12-6-7(3)13-9(11)5-2;1-3(2)4(5)6/h7-11H,4-6H2,1-3H3;1H2,2H3,(H,5,6).
What are the key properties of 1-[2-(1-hydroxypropoxy)propoxy]propan-1-ol;2-methylprop-2-enoic acid?
1-[2-(1-hydroxypropoxy)propoxy]propan-1-ol;2-methylprop-2-enoic acid has a molecular weight of 278.35 g/mol, XLogP of 1.51, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1-hydroxypropoxy)propoxy]propan-1-ol;2-methylprop-2-enoic acid is sourced from PubChem (CID 174847356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).