C17H37NO2 — CID 174805893
1-cyclopentyl-N-methylpropan-2-amine;2-ethylhexane-1,3-diol (PubChem CID 174805893) has the molecular formula C17H37NO2 and a molecular weight of 287.49 g/mol. Its IUPAC name is 1-cyclopentyl-N-methylpropan-2-amine;2-ethylhexane-1,3-diol.
| Compound Name | 1-cyclopentyl-N-methylpropan-2-amine;2-ethylhexane-1,3-diol |
|---|---|
| PubChem CID | 174805893 |
| Molecular Formula | C17H37NO2 |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.28 |
| IUPAC Name | 1-cyclopentyl-N-methylpropan-2-amine;2-ethylhexane-1,3-diol |
| SMILES | CCCC(O)C(CC)CO.CNC(C)CC1CCCC1 |
| InChI | InChI=1S/C9H19N.C8H18O2/c1-8(10-2)7-9-5-3-4-6-9;1-3-5-8(10)7(4-2)6-9/h8-10H,3-7H2,1-2H3;7-10H,3-6H2,1-2H3 |
| InChIKey | QIGNXVGFVQYKDW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |