C13H26O2 — CID 103160935
1-cyclopentyl-4-ethylhexane-2,5-diol (PubChem CID 103160935) has the molecular formula C13H26O2 and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-cyclopentyl-4-ethylhexane-2,5-diol.
| Compound Name | 1-cyclopentyl-4-ethylhexane-2,5-diol |
|---|---|
| PubChem CID | 103160935 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 1-cyclopentyl-4-ethylhexane-2,5-diol |
| SMILES | CCC(CC(O)CC1CCCC1)C(C)O |
| InChI | InChI=1S/C13H26O2/c1-3-12(10(2)14)9-13(15)8-11-6-4-5-7-11/h10-15H,3-9H2,1-2H3 |
| InChIKey | GHAKWNGPPFIMOI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |