C16H32ClNO — CID 174274064
4-amino-1,4-dicyclohexylbutan-2-ol;hydrochloride (PubChem CID 174274064) has the molecular formula C16H32ClNO and a molecular weight of 289.89 g/mol. Its IUPAC name is 4-amino-1,4-dicyclohexylbutan-2-ol;hydrochloride.
| Compound Name | 4-amino-1,4-dicyclohexylbutan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 174274064 |
| Molecular Formula | C16H32ClNO |
| Molecular Weight | 289.89 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 4-amino-1,4-dicyclohexylbutan-2-ol;hydrochloride |
| SMILES | Cl.NC(CC(O)CC1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C16H31NO.ClH/c17-16(14-9-5-2-6-10-14)12-15(18)11-13-7-3-1-4-8-13;/h13-16,18H,1-12,17H2;1H |
| InChIKey | ZUCHFSVOSVURKI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.89 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |