C6H14O2 — CID 87152899
(2S,3S)-2-ethylbutane-1,3-diol (PubChem CID 87152899) has the molecular formula C6H14O2 and a molecular weight of 118.18 g/mol. Its IUPAC name is (2S,3S)-2-ethylbutane-1,3-diol.
| Compound Name | (2S,3S)-2-ethylbutane-1,3-diol |
|---|---|
| PubChem CID | 87152899 |
| Molecular Formula | C6H14O2 |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.10 |
| IUPAC Name | (2S,3S)-2-ethylbutane-1,3-diol |
| SMILES | CC[C@@H](CO)[C@H](C)O |
| InChI | InChI=1S/C6H14O2/c1-3-6(4-7)5(2)8/h5-8H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | JULNEFHJBRHDSM-WDSKDSINSA-N |
| XLogP | 0.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |