C7H17NO2 — CID 139939202
2-(ethylaminomethyl)butane-1,3-diol (PubChem CID 139939202) has the molecular formula C7H17NO2 and a molecular weight of 147.22 g/mol. Its IUPAC name is 2-(ethylaminomethyl)butane-1,3-diol.
| Compound Name | 2-(ethylaminomethyl)butane-1,3-diol |
|---|---|
| PubChem CID | 139939202 |
| Molecular Formula | C7H17NO2 |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.13 |
| IUPAC Name | 2-(ethylaminomethyl)butane-1,3-diol |
| SMILES | CCNCC(CO)C(C)O |
| InChI | InChI=1S/C7H17NO2/c1-3-8-4-7(5-9)6(2)10/h6-10H,3-5H2,1-2H3 |
| InChIKey | FCUDXCIOGVSKQR-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |