C7H17NO2 — CID 57220298
1-amino-3-ethylpentane-1,4-diol (PubChem CID 57220298) has the molecular formula C7H17NO2 and a molecular weight of 147.22 g/mol. Its IUPAC name is 1-amino-3-ethylpentane-1,4-diol.
| Compound Name | 1-amino-3-ethylpentane-1,4-diol |
|---|---|
| PubChem CID | 57220298 |
| Molecular Formula | C7H17NO2 |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.13 |
| IUPAC Name | 1-amino-3-ethylpentane-1,4-diol |
| SMILES | CCC(CC(N)O)C(C)O |
| InChI | InChI=1S/C7H17NO2/c1-3-6(5(2)9)4-7(8)10/h5-7,9-10H,3-4,8H2,1-2H3 |
| InChIKey | XFTUQLBTOGKBNR-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|