C7H16O3 — CID 10558771
(2S,3R)-3-propan-2-ylbutane-1,2,4-triol (PubChem CID 10558771) has the molecular formula C7H16O3 and a molecular weight of 148.20 g/mol. Its IUPAC name is (2S,3R)-3-propan-2-ylbutane-1,2,4-triol.
| Compound Name | (2S,3R)-3-propan-2-ylbutane-1,2,4-triol |
|---|---|
| PubChem CID | 10558771 |
| Molecular Formula | C7H16O3 |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | (2S,3R)-3-propan-2-ylbutane-1,2,4-triol |
| SMILES | CC(C)[C@H](CO)[C@H](O)CO |
| InChI | InChI=1S/C7H16O3/c1-5(2)6(3-8)7(10)4-9/h5-10H,3-4H2,1-2H3/t6-,7+/m0/s1 |
| InChIKey | MYFMPQRTVKSLKA-NKWVEPMBSA-N |
| XLogP | -0.40 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |