C11H24O — CID 115789267
2,3,6-trimethyloctan-4-ol (PubChem CID 115789267) has the molecular formula C11H24O and a molecular weight of 172.31 g/mol. Its IUPAC name is 2,3,6-trimethyloctan-4-ol.
| Compound Name | 2,3,6-trimethyloctan-4-ol |
|---|---|
| PubChem CID | 115789267 |
| Molecular Formula | C11H24O |
| Molecular Weight | 172.31 g/mol |
| Exact Mass | 172.18 |
| IUPAC Name | 2,3,6-trimethyloctan-4-ol |
| SMILES | CCC(C)CC(O)C(C)C(C)C |
| InChI | InChI=1S/C11H24O/c1-6-9(4)7-11(12)10(5)8(2)3/h8-12H,6-7H2,1-5H3 |
| InChIKey | VMKSLFPSSMVPQP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |