About 6-ethyl-2,3-dimethyldecan-4-ol
6-ethyl-2,3-dimethyldecan-4-ol (PubChem CID 114981252) has the molecular formula C14H30O
and a molecular weight of 214.39 g/mol. Its IUPAC name is 6-ethyl-2,3-dimethyldecan-4-ol.
Molecular Properties
| Compound Name | 6-ethyl-2,3-dimethyldecan-4-ol |
| PubChem CID | 114981252 |
| Molecular Formula | C14H30O |
| Molecular Weight | 214.39 g/mol |
| Exact Mass | 214.23 |
| IUPAC Name | 6-ethyl-2,3-dimethyldecan-4-ol |
| SMILES | CCCCC(CC)CC(O)C(C)C(C)C |
| InChI | InChI=1S/C14H30O/c1-6-8-9-13(7-2)10-14(15)12(5)11(3)4/h11-15H,6-10H2,1-5H3 |
| InChIKey | QDYYWXZYIIEFIC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-ethyl-2,3-dimethyldecan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2,3-dimethyldecan-4-ol?
The IUPAC name of 6-ethyl-2,3-dimethyldecan-4-ol (CID 114981252) is 6-ethyl-2,3-dimethyldecan-4-ol.
What is the SMILES notation for 6-ethyl-2,3-dimethyldecan-4-ol?
The canonical SMILES for 6-ethyl-2,3-dimethyldecan-4-ol is CCCCC(CC)CC(O)C(C)C(C)C.
What is the InChIKey of 6-ethyl-2,3-dimethyldecan-4-ol?
The InChIKey is QDYYWXZYIIEFIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O/c1-6-8-9-13(7-2)10-14(15)12(5)11(3)4/h11-15H,6-10H2,1-5H3.
What are the key properties of 6-ethyl-2,3-dimethyldecan-4-ol?
6-ethyl-2,3-dimethyldecan-4-ol has a molecular weight of 214.39 g/mol, XLogP of 4.25, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2,3-dimethyldecan-4-ol is sourced from PubChem (CID 114981252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).