C17H36O3 — CID 88870745
(2R,3S,4R,6S,7S,9R,10R)-3,6,7,10,11-pentamethyldodecane-2,4,9-triol (PubChem CID 88870745) has the molecular formula C17H36O3 and a molecular weight of 288.47 g/mol. Its IUPAC name is (2R,3S,4R,6S,7S,9R,10R)-3,6,7,10,11-pentamethyldodecane-2,4,9-triol.
| Compound Name | (2R,3S,4R,6S,7S,9R,10R)-3,6,7,10,11-pentamethyldodecane-2,4,9-triol |
|---|---|
| PubChem CID | 88870745 |
| Molecular Formula | C17H36O3 |
| Molecular Weight | 288.47 g/mol |
| Exact Mass | 288.27 |
| IUPAC Name | (2R,3S,4R,6S,7S,9R,10R)-3,6,7,10,11-pentamethyldodecane-2,4,9-triol |
| SMILES | CC(C)[C@@H](C)[C@H](O)C[C@H](C)[C@@H](C)C[C@@H](O)[C@@H](C)[C@@H](C)O |
| InChI | InChI=1S/C17H36O3/c1-10(2)13(5)16(19)8-11(3)12(4)9-17(20)14(6)15(7)18/h10-20H,8-9H2,1-7H3/t11-,12-,13+,14-,15+,16+,17+/m0/s1 |
| InChIKey | UKWKZOYGAGGWFJ-NZLQQEQQSA-N |
| XLogP | 3.07 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |