C8H19NO — CID 174001748
(3S)-3,4-dimethyl-1-(methylamino)pentan-2-ol (PubChem CID 174001748) has the molecular formula C8H19NO and a molecular weight of 145.25 g/mol. Its IUPAC name is (3S)-3,4-dimethyl-1-(methylamino)pentan-2-ol.
| Compound Name | (3S)-3,4-dimethyl-1-(methylamino)pentan-2-ol |
|---|---|
| PubChem CID | 174001748 |
| Molecular Formula | C8H19NO |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.15 |
| IUPAC Name | (3S)-3,4-dimethyl-1-(methylamino)pentan-2-ol |
| SMILES | CNCC(O)[C@@H](C)C(C)C |
| InChI | InChI=1S/C8H19NO/c1-6(2)7(3)8(10)5-9-4/h6-10H,5H2,1-4H3/t7-,8?/m0/s1 |
| InChIKey | RFBINNDQIZOAEV-JAMMHHFISA-N |
| XLogP | 0.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |