C7H18N2O — CID 54087327
(2R,3S)-3-(dimethylamino)-1-(methylamino)butan-2-ol (PubChem CID 54087327) has the molecular formula C7H18N2O and a molecular weight of 146.23 g/mol. Its IUPAC name is (2R,3S)-3-(dimethylamino)-1-(methylamino)butan-2-ol.
| Compound Name | (2R,3S)-3-(dimethylamino)-1-(methylamino)butan-2-ol |
|---|---|
| PubChem CID | 54087327 |
| Molecular Formula | C7H18N2O |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.14 |
| IUPAC Name | (2R,3S)-3-(dimethylamino)-1-(methylamino)butan-2-ol |
| SMILES | CNC[C@@H](O)[C@H](C)N(C)C |
| InChI | InChI=1S/C7H18N2O/c1-6(9(3)4)7(10)5-8-2/h6-8,10H,5H2,1-4H3/t6-,7+/m0/s1 |
| InChIKey | MRJZUICQJIWTSS-NKWVEPMBSA-N |
| XLogP | -0.48 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |