C8H21N3 — CID 166769327
1-N,2-N,3-N,3-N-tetramethylbutane-1,2,3-triamine (PubChem CID 166769327) has the molecular formula C8H21N3 and a molecular weight of 159.28 g/mol. Its IUPAC name is 1-N,2-N,3-N,3-N-tetramethylbutane-1,2,3-triamine.
| Compound Name | 1-N,2-N,3-N,3-N-tetramethylbutane-1,2,3-triamine |
|---|---|
| PubChem CID | 166769327 |
| Molecular Formula | C8H21N3 |
| Molecular Weight | 159.28 g/mol |
| Exact Mass | 159.17 |
| IUPAC Name | 1-N,2-N,3-N,3-N-tetramethylbutane-1,2,3-triamine |
| SMILES | CNCC(NC)C(C)N(C)C |
| InChI | InChI=1S/C8H21N3/c1-7(11(4)5)8(10-3)6-9-2/h7-10H,6H2,1-5H3 |
| InChIKey | VTRGCWJDBUBINQ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.28 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |