C12H29N3 — CID 162293732
cyclopentane;1-N,1-N,1-N',1-N',2-N-pentamethylethane-1,1,2-triamine (PubChem CID 162293732) has the molecular formula C12H29N3 and a molecular weight of 215.38 g/mol. Its IUPAC name is cyclopentane;1-N,1-N,1-N',1-N',2-N-pentamethylethane-1,1,2-triamine.
| Compound Name | cyclopentane;1-N,1-N,1-N',1-N',2-N-pentamethylethane-1,1,2-triamine |
|---|---|
| PubChem CID | 162293732 |
| Molecular Formula | C12H29N3 |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.24 |
| IUPAC Name | cyclopentane;1-N,1-N,1-N',1-N',2-N-pentamethylethane-1,1,2-triamine |
| SMILES | C1CCCC1.CNCC(N(C)C)N(C)C |
| InChI | InChI=1S/C7H19N3.C5H10/c1-8-6-7(9(2)3)10(4)5;1-2-4-5-3-1/h7-8H,6H2,1-5H3;1-5H2 |
| InChIKey | RTRJQWYTUDJGFM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|