C6H19N3Si — CID 123544836
1-N,1-N,1-N',1-N'-tetramethyl-2-N-silylethane-1,1,2-triamine (PubChem CID 123544836) has the molecular formula C6H19N3Si and a molecular weight of 161.32 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N'-tetramethyl-2-N-silylethane-1,1,2-triamine.
| Compound Name | 1-N,1-N,1-N',1-N'-tetramethyl-2-N-silylethane-1,1,2-triamine |
|---|---|
| PubChem CID | 123544836 |
| Molecular Formula | C6H19N3Si |
| Molecular Weight | 161.32 g/mol |
| Exact Mass | 161.13 |
| IUPAC Name | 1-N,1-N,1-N',1-N'-tetramethyl-2-N-silylethane-1,1,2-triamine |
| SMILES | CN(C)C(CN[SiH3])N(C)C |
| InChI | InChI=1S/C6H19N3Si/c1-8(2)6(5-7-10)9(3)4/h6-7H,5H2,1-4,10H3 |
| InChIKey | LSGVSGJUKUBJOM-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.32 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|