C10H24N2 — CID 23505022
1-N,1-N,1-N',1-N',3-pentamethylpentane-1,1-diamine (PubChem CID 23505022) has the molecular formula C10H24N2 and a molecular weight of 172.32 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N',3-pentamethylpentane-1,1-diamine.
| Compound Name | 1-N,1-N,1-N',1-N',3-pentamethylpentane-1,1-diamine |
|---|---|
| PubChem CID | 23505022 |
| Molecular Formula | C10H24N2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.19 |
| IUPAC Name | 1-N,1-N,1-N',1-N',3-pentamethylpentane-1,1-diamine |
| SMILES | CCC(C)CC(N(C)C)N(C)C |
| InChI | InChI=1S/C10H24N2/c1-7-9(2)8-10(11(3)4)12(5)6/h9-10H,7-8H2,1-6H3 |
| InChIKey | FNLWBIZJAGYGFF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|