C15H36N4 — CID 87407366
1-N,1-N,1-N',1-N',7-N,7-N,7-N',7-N'-octamethylheptane-1,1,7,7-tetramine (PubChem CID 87407366) has the molecular formula C15H36N4 and a molecular weight of 272.48 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N',7-N,7-N,7-N',7-N'-octamethylheptane-1,1,7,7-tetramine.
| Compound Name | 1-N,1-N,1-N',1-N',7-N,7-N,7-N',7-N'-octamethylheptane-1,1,7,7-tetramine |
|---|---|
| PubChem CID | 87407366 |
| Molecular Formula | C15H36N4 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.29 |
| IUPAC Name | 1-N,1-N,1-N',1-N',7-N,7-N,7-N',7-N'-octamethylheptane-1,1,7,7-tetramine |
| SMILES | CN(C)C(CCCCCC(N(C)C)N(C)C)N(C)C |
| InChI | InChI=1S/C15H36N4/c1-16(2)14(17(3)4)12-10-9-11-13-15(18(5)6)19(7)8/h14-15H,9-13H2,1-8H3 |
| InChIKey | SIKIUFDOPBOLKW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|