About 1-chloro-N,N-dimethylpentadecan-1-amine
1-chloro-N,N-dimethylpentadecan-1-amine (PubChem CID 165176511) has the molecular formula C17H36ClN
and a molecular weight of 289.94 g/mol. Its IUPAC name is 1-chloro-N,N-dimethylpentadecan-1-amine.
Molecular Properties
| Compound Name | 1-chloro-N,N-dimethylpentadecan-1-amine |
| PubChem CID | 165176511 |
| Molecular Formula | C17H36ClN |
| Molecular Weight | 289.94 g/mol |
| Exact Mass | 289.25 |
| IUPAC Name | 1-chloro-N,N-dimethylpentadecan-1-amine |
| SMILES | CCCCCCCCCCCCCCC(Cl)N(C)C |
| InChI | InChI=1S/C17H36ClN/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19(2)3/h17H,4-16H2,1-3H3 |
| InChIKey | LKONRVGMVROHSS-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.94 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-N,N-dimethylpentadecan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-N,N-dimethylpentadecan-1-amine?
The IUPAC name of 1-chloro-N,N-dimethylpentadecan-1-amine (CID 165176511) is 1-chloro-N,N-dimethylpentadecan-1-amine.
What is the SMILES notation for 1-chloro-N,N-dimethylpentadecan-1-amine?
The canonical SMILES for 1-chloro-N,N-dimethylpentadecan-1-amine is CCCCCCCCCCCCCCC(Cl)N(C)C.
What is the InChIKey of 1-chloro-N,N-dimethylpentadecan-1-amine?
The InChIKey is LKONRVGMVROHSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36ClN/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19(2)3/h17H,4-16H2,1-3H3.
What are the key properties of 1-chloro-N,N-dimethylpentadecan-1-amine?
1-chloro-N,N-dimethylpentadecan-1-amine has a molecular weight of 289.94 g/mol, XLogP of 6.20, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-N,N-dimethylpentadecan-1-amine is sourced from PubChem (CID 165176511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).