C6H15ClN2 — CID 157189725
2-chloro-1-N,1-N,1-N',1-N'-tetramethylethane-1,1-diamine (PubChem CID 157189725) has the molecular formula C6H15ClN2 and a molecular weight of 150.65 g/mol. Its IUPAC name is 2-chloro-1-N,1-N,1-N',1-N'-tetramethylethane-1,1-diamine.
| Compound Name | 2-chloro-1-N,1-N,1-N',1-N'-tetramethylethane-1,1-diamine |
|---|---|
| PubChem CID | 157189725 |
| Molecular Formula | C6H15ClN2 |
| Molecular Weight | 150.65 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 2-chloro-1-N,1-N,1-N',1-N'-tetramethylethane-1,1-diamine |
| SMILES | CN(C)C(CCl)N(C)C |
| InChI | InChI=1S/C6H15ClN2/c1-8(2)6(5-7)9(3)4/h6H,5H2,1-4H3 |
| InChIKey | APOCOGMKPSTHOP-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.65 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|