C6H16N2O — CID 57031094
2,2-bis(dimethylamino)ethanol (PubChem CID 57031094) has the molecular formula C6H16N2O and a molecular weight of 132.21 g/mol. Its IUPAC name is 2,2-bis(dimethylamino)ethanol.
| Compound Name | 2,2-bis(dimethylamino)ethanol |
|---|---|
| PubChem CID | 57031094 |
| Molecular Formula | C6H16N2O |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.13 |
| IUPAC Name | 2,2-bis(dimethylamino)ethanol |
| SMILES | CN(C)C(CO)N(C)C |
| InChI | InChI=1S/C6H16N2O/c1-7(2)6(5-9)8(3)4/h6,9H,5H2,1-4H3 |
| InChIKey | OJBYWILMQGOTSF-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|