C13H31N3O2 — CID 23106300
3-[bis[1-(dimethylamino)propyl]amino]propane-1,2-diol (PubChem CID 23106300) has the molecular formula C13H31N3O2 and a molecular weight of 261.41 g/mol. Its IUPAC name is 3-[bis[1-(dimethylamino)propyl]amino]propane-1,2-diol.
| Compound Name | 3-[bis[1-(dimethylamino)propyl]amino]propane-1,2-diol |
|---|---|
| PubChem CID | 23106300 |
| Molecular Formula | C13H31N3O2 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.24 |
| IUPAC Name | 3-[bis[1-(dimethylamino)propyl]amino]propane-1,2-diol |
| SMILES | CCC(N(C)C)N(CC(O)CO)C(CC)N(C)C |
| InChI | InChI=1S/C13H31N3O2/c1-7-12(14(3)4)16(9-11(18)10-17)13(8-2)15(5)6/h11-13,17-18H,7-10H2,1-6H3 |
| InChIKey | JHXKBUGHFVWYJQ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 50.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|