C4H10NO4S- — CID 91491359
1,2-dihydroxy-3-[methyl(sulfinato)amino]propane (PubChem CID 91491359) has the molecular formula C4H10NO4S- and a molecular weight of 168.19 g/mol. Its IUPAC name is 1,2-dihydroxy-3-[methyl(sulfinato)amino]propane.
| Compound Name | 1,2-dihydroxy-3-[methyl(sulfinato)amino]propane |
|---|---|
| PubChem CID | 91491359 |
| Molecular Formula | C4H10NO4S- |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.03 |
| IUPAC Name | 1,2-dihydroxy-3-[methyl(sulfinato)amino]propane |
| SMILES | CN(CC(O)CO)S(=O)[O-] |
| InChI | InChI=1S/C4H11NO4S/c1-5(10(8)9)2-4(7)3-6/h4,6-7H,2-3H2,1H3,(H,8,9)/p-1 |
| InChIKey | AQHDGXQEUIYERI-UHFFFAOYSA-M |
| XLogP | -1.93 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|