C11H17N2O3S- — CID 170444225
[(2S,3R)-2-amino-3-hydroxy-4-[methyl(sulfinato)amino]butyl]benzene (PubChem CID 170444225) has the molecular formula C11H17N2O3S- and a molecular weight of 257.33 g/mol. Its IUPAC name is [(2S,3R)-2-amino-3-hydroxy-4-[methyl(sulfinato)amino]butyl]benzene.
| Compound Name | [(2S,3R)-2-amino-3-hydroxy-4-[methyl(sulfinato)amino]butyl]benzene |
|---|---|
| PubChem CID | 170444225 |
| Molecular Formula | C11H17N2O3S- |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | [(2S,3R)-2-amino-3-hydroxy-4-[methyl(sulfinato)amino]butyl]benzene |
| SMILES | CN(C[C@@H](O)[C@@H](N)Cc1ccccc1)S(=O)[O-] |
| InChI | InChI=1S/C11H18N2O3S/c1-13(17(15)16)8-11(14)10(12)7-9-5-3-2-4-6-9/h2-6,10-11,14H,7-8,12H2,1H3,(H,15,16)/p-1/t10-,11+/m0/s1 |
| InChIKey | BUCHKJOIUKMELV-WDEREUQCSA-M |
| XLogP | -0.36 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|