C20H27N3O4S — CID 71080611
N-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)-4-nitrobenzenesulfinamide (PubChem CID 71080611) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol. Its IUPAC name is N-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)-4-nitrobenzenesulfinamide.
| Compound Name | N-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)-4-nitrobenzenesulfinamide |
|---|---|
| PubChem CID | 71080611 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | N-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)-4-nitrobenzenesulfinamide |
| SMILES | CC(C)CN(C[C@@H](O)[C@@H](N)Cc1ccccc1)S(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H27N3O4S/c1-15(2)13-22(28(27)18-10-8-17(9-11-18)23(25)26)14-20(24)19(21)12-16-6-4-3-5-7-16/h3-11,15,19-20,24H,12-14,21H2,1-2H3/t19-,20+,28?/m0/s1 |
| InChIKey | JWTQAKLZVPFKAF-VWGXNCFZSA-N |
| XLogP | 2.51 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|