C20H28N2O — CID 141117226
(2R,3S)-3-amino-1-[N-(2-methylpropyl)anilino]-4-phenylbutan-2-ol (PubChem CID 141117226) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is (2R,3S)-3-amino-1-[N-(2-methylpropyl)anilino]-4-phenylbutan-2-ol.
| Compound Name | (2R,3S)-3-amino-1-[N-(2-methylpropyl)anilino]-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 141117226 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | (2R,3S)-3-amino-1-[N-(2-methylpropyl)anilino]-4-phenylbutan-2-ol |
| SMILES | CC(C)CN(C[C@@H](O)[C@@H](N)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H28N2O/c1-16(2)14-22(18-11-7-4-8-12-18)15-20(23)19(21)13-17-9-5-3-6-10-17/h3-12,16,19-20,23H,13-15,21H2,1-2H3/t19-,20+/m0/s1 |
| InChIKey | STUFDRNBVDNJPA-VQTJNVASSA-N |
| XLogP | 3.08 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |