C14H23NO2 — CID 10585964
(2S,3R,4S)-2-amino-6-methyl-1-phenylheptane-3,4-diol (PubChem CID 10585964) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is (2S,3R,4S)-2-amino-6-methyl-1-phenylheptane-3,4-diol.
| Compound Name | (2S,3R,4S)-2-amino-6-methyl-1-phenylheptane-3,4-diol |
|---|---|
| PubChem CID | 10585964 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | (2S,3R,4S)-2-amino-6-methyl-1-phenylheptane-3,4-diol |
| SMILES | CC(C)C[C@H](O)[C@H](O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C14H23NO2/c1-10(2)8-13(16)14(17)12(15)9-11-6-4-3-5-7-11/h3-7,10,12-14,16-17H,8-9,15H2,1-2H3/t12-,13-,14+/m0/s1 |
| InChIKey | WOACOVSEHSPAGI-MELADBBJSA-N |
| XLogP | 1.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |