C18H31NO2 — CID 57286742
(2S,3R,4S)-2-amino-1-(4-tert-butylphenyl)-6-methylheptane-3,4-diol (PubChem CID 57286742) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is (2S,3R,4S)-2-amino-1-(4-tert-butylphenyl)-6-methylheptane-3,4-diol.
| Compound Name | (2S,3R,4S)-2-amino-1-(4-tert-butylphenyl)-6-methylheptane-3,4-diol |
|---|---|
| PubChem CID | 57286742 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | (2S,3R,4S)-2-amino-1-(4-tert-butylphenyl)-6-methylheptane-3,4-diol |
| SMILES | CC(C)C[C@H](O)[C@H](O)[C@@H](N)Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H31NO2/c1-12(2)10-16(20)17(21)15(19)11-13-6-8-14(9-7-13)18(3,4)5/h6-9,12,15-17,20-21H,10-11,19H2,1-5H3/t15-,16-,17+/m0/s1 |
| InChIKey | COESLMYIWIOYSZ-YESZJQIVSA-N |
| XLogP | 2.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |