C10H15ClN2O3 — CID 71519985
(2R,3S)-3-amino-1-nitro-4-phenylbutan-2-ol;hydrochloride (PubChem CID 71519985) has the molecular formula C10H15ClN2O3 and a molecular weight of 246.69 g/mol. Its IUPAC name is (2R,3S)-3-amino-1-nitro-4-phenylbutan-2-ol;hydrochloride.
| Compound Name | (2R,3S)-3-amino-1-nitro-4-phenylbutan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 71519985 |
| Molecular Formula | C10H15ClN2O3 |
| Molecular Weight | 246.69 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | (2R,3S)-3-amino-1-nitro-4-phenylbutan-2-ol;hydrochloride |
| SMILES | Cl.N[C@@H](Cc1ccccc1)[C@H](O)C[N+](=O)[O-] |
| InChI | InChI=1S/C10H14N2O3.ClH/c11-9(10(13)7-12(14)15)6-8-4-2-1-3-5-8;/h1-5,9-10,13H,6-7,11H2;1H/t9-,10+;/m0./s1 |
| InChIKey | LXFSVGAJSDTYBF-BAUSSPIASA-N |
| XLogP | 0.62 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.69 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|