C12H17NO3 — CID 14453007
methyl (3S,4S)-4-amino-3-hydroxy-5-phenylpentanoate (PubChem CID 14453007) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is methyl (3S,4S)-4-amino-3-hydroxy-5-phenylpentanoate.
| Compound Name | methyl (3S,4S)-4-amino-3-hydroxy-5-phenylpentanoate |
|---|---|
| PubChem CID | 14453007 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | methyl (3S,4S)-4-amino-3-hydroxy-5-phenylpentanoate |
| SMILES | COC(=O)C[C@H](O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C12H17NO3/c1-16-12(15)8-11(14)10(13)7-9-5-3-2-4-6-9/h2-6,10-11,14H,7-8,13H2,1H3/t10-,11-/m0/s1 |
| InChIKey | MPVVGXNZMOJLQI-QWRGUYRKSA-N |
| XLogP | 0.48 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |