C12H15ClO3 — CID 134934579
methyl (3R,4R)-3-chloro-4-hydroxy-5-phenylpentanoate (PubChem CID 134934579) has the molecular formula C12H15ClO3 and a molecular weight of 242.70 g/mol. Its IUPAC name is methyl (3R,4R)-3-chloro-4-hydroxy-5-phenylpentanoate.
| Compound Name | methyl (3R,4R)-3-chloro-4-hydroxy-5-phenylpentanoate |
|---|---|
| PubChem CID | 134934579 |
| Molecular Formula | C12H15ClO3 |
| Molecular Weight | 242.70 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | methyl (3R,4R)-3-chloro-4-hydroxy-5-phenylpentanoate |
| SMILES | COC(=O)C[C@@H](Cl)[C@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C12H15ClO3/c1-16-12(15)8-10(13)11(14)7-9-5-3-2-4-6-9/h2-6,10-11,14H,7-8H2,1H3/t10-,11-/m1/s1 |
| InChIKey | FXMJVJBVBDADTH-GHMZBOCLSA-N |
| XLogP | 1.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.70 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|