C18H16N2O5 — CID 11493836
2-[(2R,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]isoindole-1,3-dione (PubChem CID 11493836) has the molecular formula C18H16N2O5 and a molecular weight of 340.33 g/mol. Its IUPAC name is 2-[(2R,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2R,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11493836 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-[(2R,3R)-3-hydroxy-4-nitro-1-phenylbutan-2-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1[C@H](Cc1ccccc1)[C@H](O)C[N+](=O)[O-] |
| InChI | InChI=1S/C18H16N2O5/c21-16(11-19(24)25)15(10-12-6-2-1-3-7-12)20-17(22)13-8-4-5-9-14(13)18(20)23/h1-9,15-16,21H,10-11H2/t15-,16-/m1/s1 |
| InChIKey | BXPXBRWENKFNEP-HZPDHXFCSA-N |
| XLogP | 1.53 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|