C19H16N2O3 — CID 70392189
(3S,4S)-4-(1,3-dioxoisoindol-2-yl)-3-hydroxy-5-phenylpentanenitrile (PubChem CID 70392189) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is (3S,4S)-4-(1,3-dioxoisoindol-2-yl)-3-hydroxy-5-phenylpentanenitrile.
| Compound Name | (3S,4S)-4-(1,3-dioxoisoindol-2-yl)-3-hydroxy-5-phenylpentanenitrile |
|---|---|
| PubChem CID | 70392189 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (3S,4S)-4-(1,3-dioxoisoindol-2-yl)-3-hydroxy-5-phenylpentanenitrile |
| SMILES | N#CC[C@H](O)[C@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H16N2O3/c20-11-10-17(22)16(12-13-6-2-1-3-7-13)21-18(23)14-8-4-5-9-15(14)19(21)24/h1-9,16-17,22H,10,12H2/t16-,17-/m0/s1 |
| InChIKey | KNHGMOZFKKBFAT-IRXDYDNUSA-N |
| XLogP | 2.17 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|