C24H16N2O4 — CID 22771068
(2-cyanophenyl) (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate (PubChem CID 22771068) has the molecular formula C24H16N2O4 and a molecular weight of 396.40 g/mol. Its IUPAC name is (2-cyanophenyl) (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate.
| Compound Name | (2-cyanophenyl) (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 22771068 |
| Molecular Formula | C24H16N2O4 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | (2-cyanophenyl) (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
| SMILES | N#Cc1ccccc1OC(=O)[C@@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H16N2O4/c25-15-17-10-4-7-13-21(17)30-24(29)20(14-16-8-2-1-3-9-16)26-22(27)18-11-5-6-12-19(18)23(26)28/h1-13,20H,14H2/t20-/m1/s1 |
| InChIKey | OAAZJMBBJLCNOJ-HXUWFJFHSA-N |
| XLogP | 3.37 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|