C25H21NO4 — CID 40597670
(2,3-dimethylphenyl) (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate (PubChem CID 40597670) has the molecular formula C25H21NO4 and a molecular weight of 399.45 g/mol. Its IUPAC name is (2,3-dimethylphenyl) (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate.
| Compound Name | (2,3-dimethylphenyl) (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 40597670 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (2,3-dimethylphenyl) (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
| SMILES | Cc1cccc(OC(=O)[C@H](Cc2ccccc2)N2C(=O)c3ccccc3C2=O)c1C |
| InChI | InChI=1S/C25H21NO4/c1-16-9-8-14-22(17(16)2)30-25(29)21(15-18-10-4-3-5-11-18)26-23(27)19-12-6-7-13-20(19)24(26)28/h3-14,21H,15H2,1-2H3/t21-/m0/s1 |
| InChIKey | WJMNJVMCRNAPJY-NRFANRHFSA-N |
| XLogP | 4.12 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|