C26H27NO4 — CID 7439321
(2,3-dimethylphenyl) (2S)-2-[(1S,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-phenylpropanoate (PubChem CID 7439321) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is (2,3-dimethylphenyl) (2S)-2-[(1S,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-phenylpropanoate.
| Compound Name | (2,3-dimethylphenyl) (2S)-2-[(1S,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 7439321 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (2,3-dimethylphenyl) (2S)-2-[(1S,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-phenylpropanoate |
| SMILES | Cc1cccc(OC(=O)[C@H](Cc2ccccc2)N2C(=O)[C@@H]3[C@H]4CC[C@H](C4)[C@@H]3C2=O)c1C |
| InChI | InChI=1S/C26H27NO4/c1-15-7-6-10-21(16(15)2)31-26(30)20(13-17-8-4-3-5-9-17)27-24(28)22-18-11-12-19(14-18)23(22)25(27)29/h3-10,18-20,22-23H,11-14H2,1-2H3/t18-,19+,20-,22+,23-/m0/s1 |
| InChIKey | PQBLVODFEIOMIT-SSQPMERFSA-N |
| XLogP | 3.85 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|