C25H25BrN2O3 — CID 98338676
(2R)-N-(4-bromo-2-methylphenyl)-2-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-phenylpropanamide (PubChem CID 98338676) has the molecular formula C25H25BrN2O3 and a molecular weight of 481.39 g/mol. Its IUPAC name is (2R)-N-(4-bromo-2-methylphenyl)-2-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-phenylpropanamide.
| Compound Name | (2R)-N-(4-bromo-2-methylphenyl)-2-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 98338676 |
| Molecular Formula | C25H25BrN2O3 |
| Molecular Weight | 481.39 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | (2R)-N-(4-bromo-2-methylphenyl)-2-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-3-phenylpropanamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)[C@@H](Cc1ccccc1)N1C(=O)[C@@H]2[C@H]3CC[C@@H](C3)[C@@H]2C1=O |
| InChI | InChI=1S/C25H25BrN2O3/c1-14-11-18(26)9-10-19(14)27-23(29)20(12-15-5-3-2-4-6-15)28-24(30)21-16-7-8-17(13-16)22(21)25(28)31/h2-6,9-11,16-17,20-22H,7-8,12-13H2,1H3,(H,27,29)/t16-,17-,20+,21-,22+/m0/s1 |
| InChIKey | DWAPOSLMLQJZDQ-RGBOINFLSA-N |
| XLogP | 4.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|