C24H23ClN2O3 — CID 2925821
N-(2-chlorophenyl)-2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-3-phenylpropanamide (PubChem CID 2925821) has the molecular formula C24H23ClN2O3 and a molecular weight of 422.91 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-3-phenylpropanamide.
| Compound Name | N-(2-chlorophenyl)-2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 2925821 |
| Molecular Formula | C24H23ClN2O3 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-(2-chlorophenyl)-2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-3-phenylpropanamide |
| SMILES | O=C(Nc1ccccc1Cl)C(Cc1ccccc1)N1C(=O)C2C3CCC(C3)C2C1=O |
| InChI | InChI=1S/C24H23ClN2O3/c25-17-8-4-5-9-18(17)26-22(28)19(12-14-6-2-1-3-7-14)27-23(29)20-15-10-11-16(13-15)21(20)24(27)30/h1-9,15-16,19-21H,10-13H2,(H,26,28) |
| InChIKey | SJTPZESSUTXFJT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|