C26H25BrN2O3 — CID 1331292
(2S)-N-(4-bromo-2-ethylphenyl)-2-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-phenylpropanamide (PubChem CID 1331292) has the molecular formula C26H25BrN2O3 and a molecular weight of 493.40 g/mol. Its IUPAC name is (2S)-N-(4-bromo-2-ethylphenyl)-2-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-phenylpropanamide.
| Compound Name | (2S)-N-(4-bromo-2-ethylphenyl)-2-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 1331292 |
| Molecular Formula | C26H25BrN2O3 |
| Molecular Weight | 493.40 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | (2S)-N-(4-bromo-2-ethylphenyl)-2-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-3-phenylpropanamide |
| SMILES | CCc1cc(Br)ccc1NC(=O)[C@H](Cc1ccccc1)N1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C26H25BrN2O3/c1-2-16-14-19(27)10-11-20(16)28-24(30)21(12-15-6-4-3-5-7-15)29-25(31)22-17-8-9-18(13-17)23(22)26(29)32/h3-11,14,17-18,21-23H,2,12-13H2,1H3,(H,28,30)/t17-,18+,21-,22+,23-/m0/s1 |
| InChIKey | GYRDWOBVPDFQIO-PHXJMUFTSA-N |
| XLogP | 4.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|