C18H17NO4S — CID 11267904
2-[(2R,3R)-3,4-dihydroxy-1-phenylsulfanylbutan-2-yl]isoindole-1,3-dione (PubChem CID 11267904) has the molecular formula C18H17NO4S and a molecular weight of 343.40 g/mol. Its IUPAC name is 2-[(2R,3R)-3,4-dihydroxy-1-phenylsulfanylbutan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2R,3R)-3,4-dihydroxy-1-phenylsulfanylbutan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11267904 |
| Molecular Formula | C18H17NO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 2-[(2R,3R)-3,4-dihydroxy-1-phenylsulfanylbutan-2-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1[C@@H](CSc1ccccc1)[C@@H](O)CO |
| InChI | InChI=1S/C18H17NO4S/c20-10-16(21)15(11-24-12-6-2-1-3-7-12)19-17(22)13-8-4-5-9-14(13)18(19)23/h1-9,15-16,20-21H,10-11H2/t15-,16-/m0/s1 |
| InChIKey | OWRVIFYIHZKQJI-HOTGVXAUSA-N |
| XLogP | 1.80 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|