C20H24N2O3S — CID 142964511
2-[(3S)-4-amino-3-hydroxy-1-phenylsulfanylbutan-2-yl]isoindole-1,3-dione;ethane (PubChem CID 142964511) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 2-[(3S)-4-amino-3-hydroxy-1-phenylsulfanylbutan-2-yl]isoindole-1,3-dione;ethane.
| Compound Name | 2-[(3S)-4-amino-3-hydroxy-1-phenylsulfanylbutan-2-yl]isoindole-1,3-dione;ethane |
|---|---|
| PubChem CID | 142964511 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 2-[(3S)-4-amino-3-hydroxy-1-phenylsulfanylbutan-2-yl]isoindole-1,3-dione;ethane |
| SMILES | CC.NC[C@H](O)C(CSc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H18N2O3S.C2H6/c19-10-16(21)15(11-24-12-6-2-1-3-7-12)20-17(22)13-8-4-5-9-14(13)18(20)23;1-2/h1-9,15-16,21H,10-11,19H2;1-2H3/t15?,16-;/m0./s1 |
| InChIKey | NCYRXLFLNYXPSL-UFUZRDLVSA-N |
| XLogP | 2.79 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|