C19H17NO3 — CID 122467290
2-[1-(3,5-dimethylphenyl)-2-oxopropyl]isoindole-1,3-dione (PubChem CID 122467290) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-[1-(3,5-dimethylphenyl)-2-oxopropyl]isoindole-1,3-dione.
| Compound Name | 2-[1-(3,5-dimethylphenyl)-2-oxopropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 122467290 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-[1-(3,5-dimethylphenyl)-2-oxopropyl]isoindole-1,3-dione |
| SMILES | CC(=O)C(c1cc(C)cc(C)c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H17NO3/c1-11-8-12(2)10-14(9-11)17(13(3)21)20-18(22)15-6-4-5-7-16(15)19(20)23/h4-10,17H,1-3H3 |
| InChIKey | GWZXPQIRKNEHQJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|