C22H15F6NO3 — CID 53356195
2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]-2-methylidene-3-oxopentyl]isoindole-1,3-dione (PubChem CID 53356195) has the molecular formula C22H15F6NO3 and a molecular weight of 455.35 g/mol. Its IUPAC name is 2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]-2-methylidene-3-oxopentyl]isoindole-1,3-dione.
| Compound Name | 2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]-2-methylidene-3-oxopentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 53356195 |
| Molecular Formula | C22H15F6NO3 |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]-2-methylidene-3-oxopentyl]isoindole-1,3-dione |
| SMILES | C=C(C(=O)CC)[C@@H](c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H15F6NO3/c1-3-17(30)11(2)18(29-19(31)15-6-4-5-7-16(15)20(29)32)12-8-13(21(23,24)25)10-14(9-12)22(26,27)28/h4-10,18H,2-3H2,1H3/t18-/m0/s1 |
| InChIKey | JXHMIEHTSHUSIK-SFHVURJKSA-N |
| XLogP | 5.60 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|