C16H10NO4- — CID 6948636
(2S)-2-(1,3-dioxoisoindol-2-yl)-2-phenylacetate (PubChem CID 6948636) has the molecular formula C16H10NO4- and a molecular weight of 280.26 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-2-phenylacetate.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-2-phenylacetate |
|---|---|
| PubChem CID | 6948636 |
| Molecular Formula | C16H10NO4- |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-2-phenylacetate |
| SMILES | O=C([O-])[C@H](c1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H11NO4/c18-14-11-8-4-5-9-12(11)15(19)17(14)13(16(20)21)10-6-2-1-3-7-10/h1-9,13H,(H,20,21)/p-1/t13-/m0/s1 |
| InChIKey | SYEYVZOVGXYKBL-ZDUSSCGKSA-M |
| XLogP | 0.77 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|