C17H11BrClNO3 — CID 162509906
2-[3-bromo-1-(4-chlorophenyl)-2-oxopropyl]isoindole-1,3-dione (PubChem CID 162509906) has the molecular formula C17H11BrClNO3 and a molecular weight of 392.64 g/mol. Its IUPAC name is 2-[3-bromo-1-(4-chlorophenyl)-2-oxopropyl]isoindole-1,3-dione.
| Compound Name | 2-[3-bromo-1-(4-chlorophenyl)-2-oxopropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 162509906 |
| Molecular Formula | C17H11BrClNO3 |
| Molecular Weight | 392.64 g/mol |
| Exact Mass | 390.96 |
| IUPAC Name | 2-[3-bromo-1-(4-chlorophenyl)-2-oxopropyl]isoindole-1,3-dione |
| SMILES | O=C(CBr)C(c1ccc(Cl)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H11BrClNO3/c18-9-14(21)15(10-5-7-11(19)8-6-10)20-16(22)12-3-1-2-4-13(12)17(20)23/h1-8,15H,9H2 |
| InChIKey | VPRWXWCZZQZVKN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.64 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|