C24H21NO3 — CID 139789655
2-[(1S)-2-(3,5-dimethylphenoxy)-1-phenylethyl]isoindole-1,3-dione (PubChem CID 139789655) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-[(1S)-2-(3,5-dimethylphenoxy)-1-phenylethyl]isoindole-1,3-dione.
| Compound Name | 2-[(1S)-2-(3,5-dimethylphenoxy)-1-phenylethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139789655 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-[(1S)-2-(3,5-dimethylphenoxy)-1-phenylethyl]isoindole-1,3-dione |
| SMILES | Cc1cc(C)cc(OC[C@H](c2ccccc2)N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C24H21NO3/c1-16-12-17(2)14-19(13-16)28-15-22(18-8-4-3-5-9-18)25-23(26)20-10-6-7-11-21(20)24(25)27/h3-14,22H,15H2,1-2H3/t22-/m1/s1 |
| InChIKey | VNOQGYLODLKXMD-JOCHJYFZSA-N |
| XLogP | 4.72 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|