C24H21NO4 — CID 139789664
4-methoxy-2-[(1S)-1-phenyl-2-phenylmethoxyethyl]isoindole-1,3-dione (PubChem CID 139789664) has the molecular formula C24H21NO4 and a molecular weight of 387.44 g/mol. Its IUPAC name is 4-methoxy-2-[(1S)-1-phenyl-2-phenylmethoxyethyl]isoindole-1,3-dione.
| Compound Name | 4-methoxy-2-[(1S)-1-phenyl-2-phenylmethoxyethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139789664 |
| Molecular Formula | C24H21NO4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 4-methoxy-2-[(1S)-1-phenyl-2-phenylmethoxyethyl]isoindole-1,3-dione |
| SMILES | COc1cccc2c1C(=O)N([C@H](COCc1ccccc1)c1ccccc1)C2=O |
| InChI | InChI=1S/C24H21NO4/c1-28-21-14-8-13-19-22(21)24(27)25(23(19)26)20(18-11-6-3-7-12-18)16-29-15-17-9-4-2-5-10-17/h2-14,20H,15-16H2,1H3/t20-/m1/s1 |
| InChIKey | SWJFAKNNOJDFHM-HXUWFJFHSA-N |
| XLogP | 4.25 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|