C28H29NO4 — CID 139789602
4-pentoxy-2-[(1S)-1-phenyl-2-phenylmethoxyethyl]isoindole-1,3-dione (PubChem CID 139789602) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is 4-pentoxy-2-[(1S)-1-phenyl-2-phenylmethoxyethyl]isoindole-1,3-dione.
| Compound Name | 4-pentoxy-2-[(1S)-1-phenyl-2-phenylmethoxyethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139789602 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 4-pentoxy-2-[(1S)-1-phenyl-2-phenylmethoxyethyl]isoindole-1,3-dione |
| SMILES | CCCCCOc1cccc2c1C(=O)N([C@H](COCc1ccccc1)c1ccccc1)C2=O |
| InChI | InChI=1S/C28H29NO4/c1-2-3-10-18-33-25-17-11-16-23-26(25)28(31)29(27(23)30)24(22-14-8-5-9-15-22)20-32-19-21-12-6-4-7-13-21/h4-9,11-17,24H,2-3,10,18-20H2,1H3/t24-/m1/s1 |
| InChIKey | DOTXANUUOJODHE-XMMPIXPASA-N |
| XLogP | 5.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|