C29H29NO6 — CID 139789678
tert-butyl 2-[1,3-dioxo-2-[(1S)-1-phenyl-2-phenylmethoxyethyl]isoindol-4-yl]oxyacetate (PubChem CID 139789678) has the molecular formula C29H29NO6 and a molecular weight of 487.55 g/mol. Its IUPAC name is tert-butyl 2-[1,3-dioxo-2-[(1S)-1-phenyl-2-phenylmethoxyethyl]isoindol-4-yl]oxyacetate.
| Compound Name | tert-butyl 2-[1,3-dioxo-2-[(1S)-1-phenyl-2-phenylmethoxyethyl]isoindol-4-yl]oxyacetate |
|---|---|
| PubChem CID | 139789678 |
| Molecular Formula | C29H29NO6 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | tert-butyl 2-[1,3-dioxo-2-[(1S)-1-phenyl-2-phenylmethoxyethyl]isoindol-4-yl]oxyacetate |
| SMILES | CC(C)(C)OC(=O)COc1cccc2c1C(=O)N([C@H](COCc1ccccc1)c1ccccc1)C2=O |
| InChI | InChI=1S/C29H29NO6/c1-29(2,3)36-25(31)19-35-24-16-10-15-22-26(24)28(33)30(27(22)32)23(21-13-8-5-9-14-21)18-34-17-20-11-6-4-7-12-20/h4-16,23H,17-19H2,1-3H3/t23-/m1/s1 |
| InChIKey | JLIMZFRBNQCPDU-HSZRJFAPSA-N |
| XLogP | 4.96 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|